C15H14F2N2O2 — CID 62048016
ethyl 6-[(2,4-difluorophenyl)methylamino]pyridine-3-carboxylate (PubChem CID 62048016) has the molecular formula C15H14F2N2O2 and a molecular weight of 292.29 g/mol. Its IUPAC name is ethyl 6-[(2,4-difluorophenyl)methylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[(2,4-difluorophenyl)methylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 62048016 |
| Molecular Formula | C15H14F2N2O2 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | ethyl 6-[(2,4-difluorophenyl)methylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NCc2ccc(F)cc2F)nc1 |
| InChI | InChI=1S/C15H14F2N2O2/c1-2-21-15(20)11-4-6-14(19-9-11)18-8-10-3-5-12(16)7-13(10)17/h3-7,9H,2,8H2,1H3,(H,18,19) |
| InChIKey | DHZPWICPAWKMOS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |