C16H20N4O2 — CID 37297447
ethyl 6-[[2-(dimethylamino)-4-pyridinyl]methylamino]pyridine-3-carboxylate (PubChem CID 37297447) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is ethyl 6-[[2-(dimethylamino)-4-pyridinyl]methylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[[2-(dimethylamino)-4-pyridinyl]methylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 37297447 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | ethyl 6-[[2-(dimethylamino)-4-pyridinyl]methylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NCc2ccnc(N(C)C)c2)nc1 |
| InChI | InChI=1S/C16H20N4O2/c1-4-22-16(21)13-5-6-14(19-11-13)18-10-12-7-8-17-15(9-12)20(2)3/h5-9,11H,4,10H2,1-3H3,(H,18,19) |
| InChIKey | VZAMYPJTXYQKNI-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |