C19H20N4O2 — CID 133411663
ethyl 6-[[3-(1-methylpyrazol-4-yl)phenyl]methylamino]pyridine-3-carboxylate (PubChem CID 133411663) has the molecular formula C19H20N4O2 and a molecular weight of 336.40 g/mol. Its IUPAC name is ethyl 6-[[3-(1-methylpyrazol-4-yl)phenyl]methylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-[[3-(1-methylpyrazol-4-yl)phenyl]methylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 133411663 |
| Molecular Formula | C19H20N4O2 |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | ethyl 6-[[3-(1-methylpyrazol-4-yl)phenyl]methylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NCc2cccc(-c3cnn(C)c3)c2)nc1 |
| InChI | InChI=1S/C19H20N4O2/c1-3-25-19(24)16-7-8-18(21-11-16)20-10-14-5-4-6-15(9-14)17-12-22-23(2)13-17/h4-9,11-13H,3,10H2,1-2H3,(H,20,21) |
| InChIKey | XDXFEGQDAOFYDR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |