C18H19N5 — CID 133411504
2-cyclopropyl-N-[[3-(1-methylpyrazol-4-yl)phenyl]methyl]pyrimidin-4-amine (PubChem CID 133411504) has the molecular formula C18H19N5 and a molecular weight of 305.39 g/mol. Its IUPAC name is 2-cyclopropyl-N-[[3-(1-methylpyrazol-4-yl)phenyl]methyl]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N-[[3-(1-methylpyrazol-4-yl)phenyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133411504 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-cyclopropyl-N-[[3-(1-methylpyrazol-4-yl)phenyl]methyl]pyrimidin-4-amine |
| SMILES | Cn1cc(-c2cccc(CNc3ccnc(C4CC4)n3)c2)cn1 |
| InChI | InChI=1S/C18H19N5/c1-23-12-16(11-21-23)15-4-2-3-13(9-15)10-20-17-7-8-19-18(22-17)14-5-6-14/h2-4,7-9,11-12,14H,5-6,10H2,1H3,(H,19,20,22) |
| InChIKey | MWIONXKUMYCCLV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |