C19H25N5 — CID 133297066
2-cyclopropyl-N-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]pyrimidin-4-amine (PubChem CID 133297066) has the molecular formula C19H25N5 and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-cyclopropyl-N-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 133297066 |
| Molecular Formula | C19H25N5 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 2-cyclopropyl-N-[[6-(4-methylpiperidin-1-yl)-3-pyridinyl]methyl]pyrimidin-4-amine |
| SMILES | CC1CCN(c2ccc(CNc3ccnc(C4CC4)n3)cn2)CC1 |
| InChI | InChI=1S/C19H25N5/c1-14-7-10-24(11-8-14)18-5-2-15(13-22-18)12-21-17-6-9-20-19(23-17)16-3-4-16/h2,5-6,9,13-14,16H,3-4,7-8,10-12H2,1H3,(H,20,21,23) |
| InChIKey | VOSUPJPFRDCSOR-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |