C19H21N3O4S2 — CID 133411678
N-[[3-(1-methylpyrazol-4-yl)phenyl]methyl]-2,4-bis(methylsulfonyl)aniline (PubChem CID 133411678) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[[3-(1-methylpyrazol-4-yl)phenyl]methyl]-2,4-bis(methylsulfonyl)aniline.
| Compound Name | N-[[3-(1-methylpyrazol-4-yl)phenyl]methyl]-2,4-bis(methylsulfonyl)aniline |
|---|---|
| PubChem CID | 133411678 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | N-[[3-(1-methylpyrazol-4-yl)phenyl]methyl]-2,4-bis(methylsulfonyl)aniline |
| SMILES | Cn1cc(-c2cccc(CNc3ccc(S(C)(=O)=O)cc3S(C)(=O)=O)c2)cn1 |
| InChI | InChI=1S/C19H21N3O4S2/c1-22-13-16(12-21-22)15-6-4-5-14(9-15)11-20-18-8-7-17(27(2,23)24)10-19(18)28(3,25)26/h4-10,12-13,20H,11H2,1-3H3 |
| InChIKey | CEOJMVMWYKNGPT-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |