C15H16BrNO4S2 — CID 133292918
N-[(4-bromophenyl)methyl]-2,4-bis(methylsulfonyl)aniline (PubChem CID 133292918) has the molecular formula C15H16BrNO4S2 and a molecular weight of 418.33 g/mol. Its IUPAC name is N-[(4-bromophenyl)methyl]-2,4-bis(methylsulfonyl)aniline.
| Compound Name | N-[(4-bromophenyl)methyl]-2,4-bis(methylsulfonyl)aniline |
|---|---|
| PubChem CID | 133292918 |
| Molecular Formula | C15H16BrNO4S2 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 416.97 |
| IUPAC Name | N-[(4-bromophenyl)methyl]-2,4-bis(methylsulfonyl)aniline |
| SMILES | CS(=O)(=O)c1ccc(NCc2ccc(Br)cc2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C15H16BrNO4S2/c1-22(18,19)13-7-8-14(15(9-13)23(2,20)21)17-10-11-3-5-12(16)6-4-11/h3-9,17H,10H2,1-2H3 |
| InChIKey | QGPWMOXTGAWCGS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |