C13H18ClNO4S2 — CID 115455744
N-[[1-(chloromethyl)cyclopropyl]methyl]-2,4-bis(methylsulfonyl)aniline (PubChem CID 115455744) has the molecular formula C13H18ClNO4S2 and a molecular weight of 351.88 g/mol. Its IUPAC name is N-[[1-(chloromethyl)cyclopropyl]methyl]-2,4-bis(methylsulfonyl)aniline.
| Compound Name | N-[[1-(chloromethyl)cyclopropyl]methyl]-2,4-bis(methylsulfonyl)aniline |
|---|---|
| PubChem CID | 115455744 |
| Molecular Formula | C13H18ClNO4S2 |
| Molecular Weight | 351.88 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | N-[[1-(chloromethyl)cyclopropyl]methyl]-2,4-bis(methylsulfonyl)aniline |
| SMILES | CS(=O)(=O)c1ccc(NCC2(CCl)CC2)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H18ClNO4S2/c1-20(16,17)10-3-4-11(12(7-10)21(2,18)19)15-9-13(8-14)5-6-13/h3-4,7,15H,5-6,8-9H2,1-2H3 |
| InChIKey | RKGKLNVFEXJNTN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.88 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|