C12H18ClNO4S2 — CID 65027570
N-(1-chloro-2-methylpropan-2-yl)-2,4-bis(methylsulfonyl)aniline (PubChem CID 65027570) has the molecular formula C12H18ClNO4S2 and a molecular weight of 339.87 g/mol. Its IUPAC name is N-(1-chloro-2-methylpropan-2-yl)-2,4-bis(methylsulfonyl)aniline.
| Compound Name | N-(1-chloro-2-methylpropan-2-yl)-2,4-bis(methylsulfonyl)aniline |
|---|---|
| PubChem CID | 65027570 |
| Molecular Formula | C12H18ClNO4S2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | N-(1-chloro-2-methylpropan-2-yl)-2,4-bis(methylsulfonyl)aniline |
| SMILES | CC(C)(CCl)Nc1ccc(S(C)(=O)=O)cc1S(C)(=O)=O |
| InChI | InChI=1S/C12H18ClNO4S2/c1-12(2,8-13)14-10-6-5-9(19(3,15)16)7-11(10)20(4,17)18/h5-7,14H,8H2,1-4H3 |
| InChIKey | WPXJMKVPJXSLGQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|