C13H18N2O4S2 — CID 133299706
5-[2,4-bis(methylsulfonyl)anilino]pentanenitrile (PubChem CID 133299706) has the molecular formula C13H18N2O4S2 and a molecular weight of 330.43 g/mol. Its IUPAC name is 5-[2,4-bis(methylsulfonyl)anilino]pentanenitrile.
| Compound Name | 5-[2,4-bis(methylsulfonyl)anilino]pentanenitrile |
|---|---|
| PubChem CID | 133299706 |
| Molecular Formula | C13H18N2O4S2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | 5-[2,4-bis(methylsulfonyl)anilino]pentanenitrile |
| SMILES | CS(=O)(=O)c1ccc(NCCCCC#N)c(S(C)(=O)=O)c1 |
| InChI | InChI=1S/C13H18N2O4S2/c1-20(16,17)11-6-7-12(13(10-11)21(2,18)19)15-9-5-3-4-8-14/h6-7,10,15H,3-5,9H2,1-2H3 |
| InChIKey | PXANXLKYLIOJCH-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|