C12H20N2O2S2 — CID 113487228
1-N-(4-methylsulfanylbutyl)-4-methylsulfonylbenzene-1,2-diamine (PubChem CID 113487228) has the molecular formula C12H20N2O2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 1-N-(4-methylsulfanylbutyl)-4-methylsulfonylbenzene-1,2-diamine.
| Compound Name | 1-N-(4-methylsulfanylbutyl)-4-methylsulfonylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 113487228 |
| Molecular Formula | C12H20N2O2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-N-(4-methylsulfanylbutyl)-4-methylsulfonylbenzene-1,2-diamine |
| SMILES | CSCCCCNc1ccc(S(C)(=O)=O)cc1N |
| InChI | InChI=1S/C12H20N2O2S2/c1-17-8-4-3-7-14-12-6-5-10(9-11(12)13)18(2,15)16/h5-6,9,14H,3-4,7-8,13H2,1-2H3 |
| InChIKey | BLWKPWDXWCIXAX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|