C16H20N2O2S — CID 79756350
1-N-[2-(2-methylphenyl)ethyl]-4-methylsulfonylbenzene-1,2-diamine (PubChem CID 79756350) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 1-N-[2-(2-methylphenyl)ethyl]-4-methylsulfonylbenzene-1,2-diamine.
| Compound Name | 1-N-[2-(2-methylphenyl)ethyl]-4-methylsulfonylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 79756350 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-N-[2-(2-methylphenyl)ethyl]-4-methylsulfonylbenzene-1,2-diamine |
| SMILES | Cc1ccccc1CCNc1ccc(S(C)(=O)=O)cc1N |
| InChI | InChI=1S/C16H20N2O2S/c1-12-5-3-4-6-13(12)9-10-18-16-8-7-14(11-15(16)17)21(2,19)20/h3-8,11,18H,9-10,17H2,1-2H3 |
| InChIKey | IBBGLKHYVHHSBY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|