C11H19N3O2S2 — CID 113487240
3-amino-4-(4-methylsulfanylbutylamino)benzenesulfonamide (PubChem CID 113487240) has the molecular formula C11H19N3O2S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is 3-amino-4-(4-methylsulfanylbutylamino)benzenesulfonamide.
| Compound Name | 3-amino-4-(4-methylsulfanylbutylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 113487240 |
| Molecular Formula | C11H19N3O2S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 3-amino-4-(4-methylsulfanylbutylamino)benzenesulfonamide |
| SMILES | CSCCCCNc1ccc(S(N)(=O)=O)cc1N |
| InChI | InChI=1S/C11H19N3O2S2/c1-17-7-3-2-6-14-11-5-4-9(8-10(11)12)18(13,15)16/h4-5,8,14H,2-3,6-7,12H2,1H3,(H2,13,15,16) |
| InChIKey | CJJMKESIMRBIRU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|