C10H15FN2S — CID 63982479
4-fluoro-1-N-(3-methylsulfanylpropyl)benzene-1,2-diamine (PubChem CID 63982479) has the molecular formula C10H15FN2S and a molecular weight of 214.31 g/mol. Its IUPAC name is 4-fluoro-1-N-(3-methylsulfanylpropyl)benzene-1,2-diamine.
| Compound Name | 4-fluoro-1-N-(3-methylsulfanylpropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 63982479 |
| Molecular Formula | C10H15FN2S |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.09 |
| IUPAC Name | 4-fluoro-1-N-(3-methylsulfanylpropyl)benzene-1,2-diamine |
| SMILES | CSCCCNc1ccc(F)cc1N |
| InChI | InChI=1S/C10H15FN2S/c1-14-6-2-5-13-10-4-3-8(11)7-9(10)12/h3-4,7,13H,2,5-6,12H2,1H3 |
| InChIKey | SZOCKTBCCQNVII-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|