About 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine
2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine (PubChem CID 63983332) has the molecular formula C11H16F2N2S
and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine.
Molecular Properties
| Compound Name | 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine |
| PubChem CID | 63983332 |
| Molecular Formula | C11H16F2N2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine |
| SMILES | CSCCCNc1ccc(N)cc1C(F)F |
| InChI | InChI=1S/C11H16F2N2S/c1-16-6-2-5-15-10-4-3-8(14)7-9(10)11(12)13/h3-4,7,11,15H,2,5-6,14H2,1H3 |
| InChIKey | DBHSMGIDTCIJFT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine?
The IUPAC name of 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine (CID 63983332) is 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine.
What is the SMILES notation for 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine?
The canonical SMILES for 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine is CSCCCNc1ccc(N)cc1C(F)F.
What is the InChIKey of 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine?
The InChIKey is DBHSMGIDTCIJFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16F2N2S/c1-16-6-2-5-15-10-4-3-8(14)7-9(10)11(12)13/h3-4,7,11,15H,2,5-6,14H2,1H3.
What are the key properties of 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine?
2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine has a molecular weight of 246.33 g/mol, XLogP of 3.37, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine is sourced from PubChem (CID 63983332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).