C11H16F2N2S — CID 63983332
2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine (PubChem CID 63983332) has the molecular formula C11H16F2N2S and a molecular weight of 246.33 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine.
| Compound Name | 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 63983332 |
| Molecular Formula | C11H16F2N2S |
| Molecular Weight | 246.33 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 2-(difluoromethyl)-1-N-(3-methylsulfanylpropyl)benzene-1,4-diamine |
| SMILES | CSCCCNc1ccc(N)cc1C(F)F |
| InChI | InChI=1S/C11H16F2N2S/c1-16-6-2-5-15-10-4-3-8(14)7-9(10)11(12)13/h3-4,7,11,15H,2,5-6,14H2,1H3 |
| InChIKey | DBHSMGIDTCIJFT-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|