C15H24F2N2 — CID 115566133
2-(difluoromethyl)-1-N-octylbenzene-1,4-diamine (PubChem CID 115566133) has the molecular formula C15H24F2N2 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-N-octylbenzene-1,4-diamine.
| Compound Name | 2-(difluoromethyl)-1-N-octylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 115566133 |
| Molecular Formula | C15H24F2N2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.19 |
| IUPAC Name | 2-(difluoromethyl)-1-N-octylbenzene-1,4-diamine |
| SMILES | CCCCCCCCNc1ccc(N)cc1C(F)F |
| InChI | InChI=1S/C15H24F2N2/c1-2-3-4-5-6-7-10-19-14-9-8-12(18)11-13(14)15(16)17/h8-9,11,15,19H,2-7,10,18H2,1H3 |
| InChIKey | VHZFDUBGUJGKFU-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|