C16H29N3S — CID 155703052
2-(dimethylaminosulfanyl)-1-N-octylbenzene-1,4-diamine (PubChem CID 155703052) has the molecular formula C16H29N3S and a molecular weight of 295.50 g/mol. Its IUPAC name is 2-(dimethylaminosulfanyl)-1-N-octylbenzene-1,4-diamine.
| Compound Name | 2-(dimethylaminosulfanyl)-1-N-octylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 155703052 |
| Molecular Formula | C16H29N3S |
| Molecular Weight | 295.50 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 2-(dimethylaminosulfanyl)-1-N-octylbenzene-1,4-diamine |
| SMILES | CCCCCCCCNc1ccc(N)cc1SN(C)C |
| InChI | InChI=1S/C16H29N3S/c1-4-5-6-7-8-9-12-18-15-11-10-14(17)13-16(15)20-19(2)3/h10-11,13,18H,4-9,12,17H2,1-3H3 |
| InChIKey | FIOHSTUHBYSHIY-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.50 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|