C9H9F5N2 — CID 63749720
2-(difluoromethyl)-1-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine (PubChem CID 63749720) has the molecular formula C9H9F5N2 and a molecular weight of 240.18 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine.
| Compound Name | 2-(difluoromethyl)-1-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 63749720 |
| Molecular Formula | C9H9F5N2 |
| Molecular Weight | 240.18 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-(difluoromethyl)-1-N-(2,2,2-trifluoroethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCC(F)(F)F)c(C(F)F)c1 |
| InChI | InChI=1S/C9H9F5N2/c10-8(11)6-3-5(15)1-2-7(6)16-4-9(12,13)14/h1-3,8,16H,4,15H2 |
| InChIKey | VKYAXFWGEXRBTH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.18 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|