C13H13F2N3 — CID 63750057
2-(difluoromethyl)-1-N-(pyridin-2-ylmethyl)benzene-1,4-diamine (PubChem CID 63750057) has the molecular formula C13H13F2N3 and a molecular weight of 249.26 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-N-(pyridin-2-ylmethyl)benzene-1,4-diamine.
| Compound Name | 2-(difluoromethyl)-1-N-(pyridin-2-ylmethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 63750057 |
| Molecular Formula | C13H13F2N3 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 2-(difluoromethyl)-1-N-(pyridin-2-ylmethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCc2ccccn2)c(C(F)F)c1 |
| InChI | InChI=1S/C13H13F2N3/c14-13(15)11-7-9(16)4-5-12(11)18-8-10-3-1-2-6-17-10/h1-7,13,18H,8,16H2 |
| InChIKey | FXBHEPDDEYQURL-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|