C13H11F2N3S — CID 107934445
2,3-difluoro-4-(pyridin-2-ylmethylamino)benzenecarbothioamide (PubChem CID 107934445) has the molecular formula C13H11F2N3S and a molecular weight of 279.31 g/mol. Its IUPAC name is 2,3-difluoro-4-(pyridin-2-ylmethylamino)benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-(pyridin-2-ylmethylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107934445 |
| Molecular Formula | C13H11F2N3S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 2,3-difluoro-4-(pyridin-2-ylmethylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCc2ccccn2)c(F)c1F |
| InChI | InChI=1S/C13H11F2N3S/c14-11-9(13(16)19)4-5-10(12(11)15)18-7-8-3-1-2-6-17-8/h1-6,18H,7H2,(H2,16,19) |
| InChIKey | QSFNXRONIQOECW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|