C11H11F2N5S — CID 107934886
2,3-difluoro-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide (PubChem CID 107934886) has the molecular formula C11H11F2N5S and a molecular weight of 283.31 g/mol. Its IUPAC name is 2,3-difluoro-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107934886 |
| Molecular Formula | C11H11F2N5S |
| Molecular Weight | 283.31 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2,3-difluoro-4-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide |
| SMILES | Cn1cnnc1CNc1ccc(C(N)=S)c(F)c1F |
| InChI | InChI=1S/C11H11F2N5S/c1-18-5-16-17-8(18)4-15-7-3-2-6(11(14)19)9(12)10(7)13/h2-3,5,15H,4H2,1H3,(H2,14,19) |
| InChIKey | RDZRYGACRIMUKH-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.31 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|