C11H12BrN5S — CID 114891679
5-bromo-2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide (PubChem CID 114891679) has the molecular formula C11H12BrN5S and a molecular weight of 326.22 g/mol. Its IUPAC name is 5-bromo-2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide.
| Compound Name | 5-bromo-2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114891679 |
| Molecular Formula | C11H12BrN5S |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 5-bromo-2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzenecarbothioamide |
| SMILES | Cn1cnnc1CNc1ccc(Br)cc1C(N)=S |
| InChI | InChI=1S/C11H12BrN5S/c1-17-6-15-16-10(17)5-14-9-3-2-7(12)4-8(9)11(13)18/h2-4,6,14H,5H2,1H3,(H2,13,18) |
| InChIKey | BTBGDKAEPICKGE-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|