C11H15BrN2OS — CID 102698271
5-bromo-2-(2-methoxypropylamino)benzenecarbothioamide (PubChem CID 102698271) has the molecular formula C11H15BrN2OS and a molecular weight of 303.23 g/mol. Its IUPAC name is 5-bromo-2-(2-methoxypropylamino)benzenecarbothioamide.
| Compound Name | 5-bromo-2-(2-methoxypropylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 102698271 |
| Molecular Formula | C11H15BrN2OS |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | 5-bromo-2-(2-methoxypropylamino)benzenecarbothioamide |
| SMILES | COC(C)CNc1ccc(Br)cc1C(N)=S |
| InChI | InChI=1S/C11H15BrN2OS/c1-7(15-2)6-14-10-4-3-8(12)5-9(10)11(13)16/h3-5,7,14H,6H2,1-2H3,(H2,13,16) |
| InChIKey | ZFCVCEGWVFBKPB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|