C11H13BrF2N2OS — CID 114127801
5-bromo-2-[2-(2,2-difluoroethoxy)ethylamino]benzenecarbothioamide (PubChem CID 114127801) has the molecular formula C11H13BrF2N2OS and a molecular weight of 339.21 g/mol. Its IUPAC name is 5-bromo-2-[2-(2,2-difluoroethoxy)ethylamino]benzenecarbothioamide.
| Compound Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 114127801 |
| Molecular Formula | C11H13BrF2N2OS |
| Molecular Weight | 339.21 g/mol |
| Exact Mass | 337.99 |
| IUPAC Name | 5-bromo-2-[2-(2,2-difluoroethoxy)ethylamino]benzenecarbothioamide |
| SMILES | NC(=S)c1cc(Br)ccc1NCCOCC(F)F |
| InChI | InChI=1S/C11H13BrF2N2OS/c12-7-1-2-9(8(5-7)11(15)18)16-3-4-17-6-10(13)14/h1-2,5,10,16H,3-4,6H2,(H2,15,18) |
| InChIKey | IGXBDZCNRPZSJM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.21 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|