C11H11BrF2N2O — CID 103081371
3-bromo-4-[2-(2,2-difluoroethoxy)ethylamino]benzonitrile (PubChem CID 103081371) has the molecular formula C11H11BrF2N2O and a molecular weight of 305.12 g/mol. Its IUPAC name is 3-bromo-4-[2-(2,2-difluoroethoxy)ethylamino]benzonitrile.
| Compound Name | 3-bromo-4-[2-(2,2-difluoroethoxy)ethylamino]benzonitrile |
|---|---|
| PubChem CID | 103081371 |
| Molecular Formula | C11H11BrF2N2O |
| Molecular Weight | 305.12 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | 3-bromo-4-[2-(2,2-difluoroethoxy)ethylamino]benzonitrile |
| SMILES | N#Cc1ccc(NCCOCC(F)F)c(Br)c1 |
| InChI | InChI=1S/C11H11BrF2N2O/c12-9-5-8(6-15)1-2-10(9)16-3-4-17-7-11(13)14/h1-2,5,11,16H,3-4,7H2 |
| InChIKey | BWGHVOPTNXSUPF-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.12 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|