C11H11BrF3NO3 — CID 114129111
2-bromo-4-[2-(2,2-difluoroethoxy)ethylamino]-3-fluorobenzoic acid (PubChem CID 114129111) has the molecular formula C11H11BrF3NO3 and a molecular weight of 342.11 g/mol. Its IUPAC name is 2-bromo-4-[2-(2,2-difluoroethoxy)ethylamino]-3-fluorobenzoic acid.
| Compound Name | 2-bromo-4-[2-(2,2-difluoroethoxy)ethylamino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 114129111 |
| Molecular Formula | C11H11BrF3NO3 |
| Molecular Weight | 342.11 g/mol |
| Exact Mass | 340.99 |
| IUPAC Name | 2-bromo-4-[2-(2,2-difluoroethoxy)ethylamino]-3-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(NCCOCC(F)F)c(F)c1Br |
| InChI | InChI=1S/C11H11BrF3NO3/c12-9-6(11(17)18)1-2-7(10(9)15)16-3-4-19-5-8(13)14/h1-2,8,16H,3-5H2,(H,17,18) |
| InChIKey | IMWXXPOVRGCUPY-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.11 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|