C10H8Br2FNO2 — CID 107540479
2-bromo-4-(2-bromoprop-2-enylamino)-3-fluorobenzoic acid (PubChem CID 107540479) has the molecular formula C10H8Br2FNO2 and a molecular weight of 352.99 g/mol. Its IUPAC name is 2-bromo-4-(2-bromoprop-2-enylamino)-3-fluorobenzoic acid.
| Compound Name | 2-bromo-4-(2-bromoprop-2-enylamino)-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 107540479 |
| Molecular Formula | C10H8Br2FNO2 |
| Molecular Weight | 352.99 g/mol |
| Exact Mass | 350.89 |
| IUPAC Name | 2-bromo-4-(2-bromoprop-2-enylamino)-3-fluorobenzoic acid |
| SMILES | C=C(Br)CNc1ccc(C(=O)O)c(Br)c1F |
| InChI | InChI=1S/C10H8Br2FNO2/c1-5(11)4-14-7-3-2-6(10(15)16)8(12)9(7)13/h2-3,14H,1,4H2,(H,15,16) |
| InChIKey | FTSMGYYXVXVXMF-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.99 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |