C16H21BrFNO2 — CID 107539901
2-bromo-4-[(4-ethylcyclohexyl)methylamino]-3-fluorobenzoic acid (PubChem CID 107539901) has the molecular formula C16H21BrFNO2 and a molecular weight of 358.25 g/mol. Its IUPAC name is 2-bromo-4-[(4-ethylcyclohexyl)methylamino]-3-fluorobenzoic acid.
| Compound Name | 2-bromo-4-[(4-ethylcyclohexyl)methylamino]-3-fluorobenzoic acid |
|---|---|
| PubChem CID | 107539901 |
| Molecular Formula | C16H21BrFNO2 |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | 2-bromo-4-[(4-ethylcyclohexyl)methylamino]-3-fluorobenzoic acid |
| SMILES | CCC1CCC(CNc2ccc(C(=O)O)c(Br)c2F)CC1 |
| InChI | InChI=1S/C16H21BrFNO2/c1-2-10-3-5-11(6-4-10)9-19-13-8-7-12(16(20)21)14(17)15(13)18/h7-8,10-11,19H,2-6,9H2,1H3,(H,20,21) |
| InChIKey | TVASNZUJZBFCSA-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |