C7H3BrF2O2 — CID 22621204
2-bromo-3,4-difluorobenzoic acid (PubChem CID 22621204) has the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. Its IUPAC name is 2-bromo-3,4-difluorobenzoic acid.
| Compound Name | 2-bromo-3,4-difluorobenzoic acid |
|---|---|
| PubChem CID | 22621204 |
| Molecular Formula | C7H3BrF2O2 |
| Molecular Weight | 237.00 g/mol |
| Exact Mass | 235.93 |
| IUPAC Name | 2-bromo-3,4-difluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C7H3BrF2O2/c8-5-3(7(11)12)1-2-4(9)6(5)10/h1-2H,(H,11,12) |
| InChIKey | SPVFFPDJYPMULI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.00 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|