2-bromo-3,4-difluorobenzoic acid

C7H3BrF2O2 — CID 22621204

IUPAC2-bromo-3,4-difluorobenzoic acid
SMILESO=C(O)c1ccc(F)c(F)c1Br
InChIInChI=1S/C7H3BrF2O2/c8-5-3(7(11)12)1-2-4(9)6(5)10/h1-2H,(H,11,12)
InChIKeySPVFFPDJYPMULI-UHFFFAOYSA-N
MW237.00 g/mol
LogP2.43
Rot. Bonds1

About 2-bromo-3,4-difluorobenzoic acid

2-bromo-3,4-difluorobenzoic acid (PubChem CID 22621204) has the molecular formula C7H3BrF2O2 and a molecular weight of 237.00 g/mol. Its IUPAC name is 2-bromo-3,4-difluorobenzoic acid.

Molecular Properties

Compound Name2-bromo-3,4-difluorobenzoic acid
PubChem CID22621204
Molecular FormulaC7H3BrF2O2
Molecular Weight237.00 g/mol
Exact Mass235.93
IUPAC Name2-bromo-3,4-difluorobenzoic acid
SMILESO=C(O)c1ccc(F)c(F)c1Br
InChIInChI=1S/C7H3BrF2O2/c8-5-3(7(11)12)1-2-4(9)6(5)10/h1-2H,(H,11,12)
InChIKeySPVFFPDJYPMULI-UHFFFAOYSA-N
XLogP2.43
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.00
LogP ≤ 52.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2-bromo-3,4-difluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-bromo-3,4-difluorobenzoic acid?
The IUPAC name of 2-bromo-3,4-difluorobenzoic acid (CID 22621204) is 2-bromo-3,4-difluorobenzoic acid.
What is the SMILES notation for 2-bromo-3,4-difluorobenzoic acid?
The canonical SMILES for 2-bromo-3,4-difluorobenzoic acid is O=C(O)c1ccc(F)c(F)c1Br.
What is the InChIKey of 2-bromo-3,4-difluorobenzoic acid?
The InChIKey is SPVFFPDJYPMULI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3BrF2O2/c8-5-3(7(11)12)1-2-4(9)6(5)10/h1-2H,(H,11,12).
What are the key properties of 2-bromo-3,4-difluorobenzoic acid?
2-bromo-3,4-difluorobenzoic acid has a molecular weight of 237.00 g/mol, XLogP of 2.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-3,4-difluorobenzoic acid is sourced from PubChem (CID 22621204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).