C11H7BrF2O — CID 107538046
1-(2-bromo-3,4-difluorophenyl)pent-4-yn-1-one (PubChem CID 107538046) has the molecular formula C11H7BrF2O and a molecular weight of 273.08 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)pent-4-yn-1-one.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)pent-4-yn-1-one |
|---|---|
| PubChem CID | 107538046 |
| Molecular Formula | C11H7BrF2O |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)pent-4-yn-1-one |
| SMILES | C#CCCC(=O)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C11H7BrF2O/c1-2-3-4-9(15)7-5-6-8(13)11(14)10(7)12/h1,5-6H,3-4H2 |
| InChIKey | IJNYDNJJACXKIN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|