C14H7BrClF3O — CID 107538110
1-(2-bromo-3,4-difluorophenyl)-2-(4-chloro-2-fluorophenyl)ethanone (PubChem CID 107538110) has the molecular formula C14H7BrClF3O and a molecular weight of 363.56 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-2-(4-chloro-2-fluorophenyl)ethanone.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-2-(4-chloro-2-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 107538110 |
| Molecular Formula | C14H7BrClF3O |
| Molecular Weight | 363.56 g/mol |
| Exact Mass | 361.93 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-2-(4-chloro-2-fluorophenyl)ethanone |
| SMILES | O=C(Cc1ccc(Cl)cc1F)c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C14H7BrClF3O/c15-13-9(3-4-10(17)14(13)19)12(20)5-7-1-2-8(16)6-11(7)18/h1-4,6H,5H2 |
| InChIKey | DJRHMFWTVHRTAG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|