C11H12BrF2NO3 — CID 103097013
5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-2-hydroxybenzamide (PubChem CID 103097013) has the molecular formula C11H12BrF2NO3 and a molecular weight of 324.12 g/mol. Its IUPAC name is 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-2-hydroxybenzamide.
| Compound Name | 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-2-hydroxybenzamide |
|---|---|
| PubChem CID | 103097013 |
| Molecular Formula | C11H12BrF2NO3 |
| Molecular Weight | 324.12 g/mol |
| Exact Mass | 323.00 |
| IUPAC Name | 5-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-2-hydroxybenzamide |
| SMILES | O=C(NCCOCC(F)F)c1cc(Br)ccc1O |
| InChI | InChI=1S/C11H12BrF2NO3/c12-7-1-2-9(16)8(5-7)11(17)15-3-4-18-6-10(13)14/h1-2,5,10,16H,3-4,6H2,(H,15,17) |
| InChIKey | KWBITJJZCZSACR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.12 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|