C12H14BrF2NO2 — CID 103082770
2-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-5-methylbenzamide (PubChem CID 103082770) has the molecular formula C12H14BrF2NO2 and a molecular weight of 322.15 g/mol. Its IUPAC name is 2-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-5-methylbenzamide.
| Compound Name | 2-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-5-methylbenzamide |
|---|---|
| PubChem CID | 103082770 |
| Molecular Formula | C12H14BrF2NO2 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 2-bromo-N-[2-(2,2-difluoroethoxy)ethyl]-5-methylbenzamide |
| SMILES | Cc1ccc(Br)c(C(=O)NCCOCC(F)F)c1 |
| InChI | InChI=1S/C12H14BrF2NO2/c1-8-2-3-10(13)9(6-8)12(17)16-4-5-18-7-11(14)15/h2-3,6,11H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | ATQHKNSVTQQBIK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|