C11H12ClF3N2OS — CID 55260697
5-chloro-2-[2-(2,2,2-trifluoroethoxy)ethylamino]benzenecarbothioamide (PubChem CID 55260697) has the molecular formula C11H12ClF3N2OS and a molecular weight of 312.74 g/mol. Its IUPAC name is 5-chloro-2-[2-(2,2,2-trifluoroethoxy)ethylamino]benzenecarbothioamide.
| Compound Name | 5-chloro-2-[2-(2,2,2-trifluoroethoxy)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 55260697 |
| Molecular Formula | C11H12ClF3N2OS |
| Molecular Weight | 312.74 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 5-chloro-2-[2-(2,2,2-trifluoroethoxy)ethylamino]benzenecarbothioamide |
| SMILES | NC(=S)c1cc(Cl)ccc1NCCOCC(F)(F)F |
| InChI | InChI=1S/C11H12ClF3N2OS/c12-7-1-2-9(8(5-7)10(16)19)17-3-4-18-6-11(13,14)15/h1-2,5,17H,3-4,6H2,(H2,16,19) |
| InChIKey | VTGWKJYGCASAFH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.74 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|