C11H11BrF4N2OS — CID 107535134
2-bromo-3-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethylamino]benzenecarbothioamide (PubChem CID 107535134) has the molecular formula C11H11BrF4N2OS and a molecular weight of 375.19 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethylamino]benzenecarbothioamide.
| Compound Name | 2-bromo-3-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107535134 |
| Molecular Formula | C11H11BrF4N2OS |
| Molecular Weight | 375.19 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | 2-bromo-3-fluoro-4-[2-(2,2,2-trifluoroethoxy)ethylamino]benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCCOCC(F)(F)F)c(F)c1Br |
| InChI | InChI=1S/C11H11BrF4N2OS/c12-8-6(10(17)20)1-2-7(9(8)13)18-3-4-19-5-11(14,15)16/h1-2,18H,3-5H2,(H2,17,20) |
| InChIKey | GIWSOELVQOXAGC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.19 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|