C12H15BrFN3OS — CID 106096810
3-(3-bromo-4-carbamothioyl-2-fluoroanilino)-3-methylbutanamide (PubChem CID 106096810) has the molecular formula C12H15BrFN3OS and a molecular weight of 348.24 g/mol. Its IUPAC name is 3-(3-bromo-4-carbamothioyl-2-fluoroanilino)-3-methylbutanamide.
| Compound Name | 3-(3-bromo-4-carbamothioyl-2-fluoroanilino)-3-methylbutanamide |
|---|---|
| PubChem CID | 106096810 |
| Molecular Formula | C12H15BrFN3OS |
| Molecular Weight | 348.24 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | 3-(3-bromo-4-carbamothioyl-2-fluoroanilino)-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)Nc1ccc(C(N)=S)c(Br)c1F |
| InChI | InChI=1S/C12H15BrFN3OS/c1-12(2,5-8(15)18)17-7-4-3-6(11(16)19)9(13)10(7)14/h3-4,17H,5H2,1-2H3,(H2,15,18)(H2,16,19) |
| InChIKey | OPWFAMPHTJZVAA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|