C12H11BrFN3S2 — CID 107534862
2-bromo-3-fluoro-4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzenecarbothioamide (PubChem CID 107534862) has the molecular formula C12H11BrFN3S2 and a molecular weight of 360.28 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzenecarbothioamide.
| Compound Name | 2-bromo-3-fluoro-4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107534862 |
| Molecular Formula | C12H11BrFN3S2 |
| Molecular Weight | 360.28 g/mol |
| Exact Mass | 358.96 |
| IUPAC Name | 2-bromo-3-fluoro-4-[(2-methyl-1,3-thiazol-4-yl)methylamino]benzenecarbothioamide |
| SMILES | Cc1nc(CNc2ccc(C(N)=S)c(Br)c2F)cs1 |
| InChI | InChI=1S/C12H11BrFN3S2/c1-6-17-7(5-19-6)4-16-9-3-2-8(12(15)18)10(13)11(9)14/h2-3,5,16H,4H2,1H3,(H2,15,18) |
| InChIKey | FBUSBVCDSSFAOK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.28 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|