C15H15BrFN3S — CID 107535317
2-bromo-4-[(3-ethyl-2-pyridinyl)methylamino]-3-fluorobenzenecarbothioamide (PubChem CID 107535317) has the molecular formula C15H15BrFN3S and a molecular weight of 368.28 g/mol. Its IUPAC name is 2-bromo-4-[(3-ethyl-2-pyridinyl)methylamino]-3-fluorobenzenecarbothioamide.
| Compound Name | 2-bromo-4-[(3-ethyl-2-pyridinyl)methylamino]-3-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107535317 |
| Molecular Formula | C15H15BrFN3S |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | 2-bromo-4-[(3-ethyl-2-pyridinyl)methylamino]-3-fluorobenzenecarbothioamide |
| SMILES | CCc1cccnc1CNc1ccc(C(N)=S)c(Br)c1F |
| InChI | InChI=1S/C15H15BrFN3S/c1-2-9-4-3-7-19-12(9)8-20-11-6-5-10(15(18)21)13(16)14(11)17/h3-7,20H,2,8H2,1H3,(H2,18,21) |
| InChIKey | QARQSAKGUQLBET-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|