C11H15BrFN3O2S2 — CID 106339106
2-bromo-3-fluoro-4-[3-(methanesulfonamido)propylamino]benzenecarbothioamide (PubChem CID 106339106) has the molecular formula C11H15BrFN3O2S2 and a molecular weight of 384.30 g/mol. Its IUPAC name is 2-bromo-3-fluoro-4-[3-(methanesulfonamido)propylamino]benzenecarbothioamide.
| Compound Name | 2-bromo-3-fluoro-4-[3-(methanesulfonamido)propylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 106339106 |
| Molecular Formula | C11H15BrFN3O2S2 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 2-bromo-3-fluoro-4-[3-(methanesulfonamido)propylamino]benzenecarbothioamide |
| SMILES | CS(=O)(=O)NCCCNc1ccc(C(N)=S)c(Br)c1F |
| InChI | InChI=1S/C11H15BrFN3O2S2/c1-20(17,18)16-6-2-5-15-8-4-3-7(11(14)19)9(12)10(8)13/h3-4,15-16H,2,5-6H2,1H3,(H2,14,19) |
| InChIKey | PNSSSMVITNYLBL-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|