C12H15F2N3OS — CID 106237310
5-(4-carbamothioyl-2,3-difluoroanilino)pentanamide (PubChem CID 106237310) has the molecular formula C12H15F2N3OS and a molecular weight of 287.33 g/mol. Its IUPAC name is 5-(4-carbamothioyl-2,3-difluoroanilino)pentanamide.
| Compound Name | 5-(4-carbamothioyl-2,3-difluoroanilino)pentanamide |
|---|---|
| PubChem CID | 106237310 |
| Molecular Formula | C12H15F2N3OS |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 5-(4-carbamothioyl-2,3-difluoroanilino)pentanamide |
| SMILES | NC(=O)CCCCNc1ccc(C(N)=S)c(F)c1F |
| InChI | InChI=1S/C12H15F2N3OS/c13-10-7(12(16)19)4-5-8(11(10)14)17-6-2-1-3-9(15)18/h4-5,17H,1-3,6H2,(H2,15,18)(H2,16,19) |
| InChIKey | XJAHJTBOKLJVAX-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|