C14H19F2N3OS — CID 107934510
2,3-difluoro-4-(3-morpholin-4-ylpropylamino)benzenecarbothioamide (PubChem CID 107934510) has the molecular formula C14H19F2N3OS and a molecular weight of 315.39 g/mol. Its IUPAC name is 2,3-difluoro-4-(3-morpholin-4-ylpropylamino)benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-(3-morpholin-4-ylpropylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107934510 |
| Molecular Formula | C14H19F2N3OS |
| Molecular Weight | 315.39 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2,3-difluoro-4-(3-morpholin-4-ylpropylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(NCCCN2CCOCC2)c(F)c1F |
| InChI | InChI=1S/C14H19F2N3OS/c15-12-10(14(17)21)2-3-11(13(12)16)18-4-1-5-19-6-8-20-9-7-19/h2-3,18H,1,4-9H2,(H2,17,21) |
| InChIKey | KHVILBYNFUWHLS-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|