C14H18F2N2O3 — CID 79834479
2,3-difluoro-4-(3-morpholin-4-ylpropylamino)benzoic acid (PubChem CID 79834479) has the molecular formula C14H18F2N2O3 and a molecular weight of 300.30 g/mol. Its IUPAC name is 2,3-difluoro-4-(3-morpholin-4-ylpropylamino)benzoic acid.
| Compound Name | 2,3-difluoro-4-(3-morpholin-4-ylpropylamino)benzoic acid |
|---|---|
| PubChem CID | 79834479 |
| Molecular Formula | C14H18F2N2O3 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2,3-difluoro-4-(3-morpholin-4-ylpropylamino)benzoic acid |
| SMILES | O=C(O)c1ccc(NCCCN2CCOCC2)c(F)c1F |
| InChI | InChI=1S/C14H18F2N2O3/c15-12-10(14(19)20)2-3-11(13(12)16)17-4-1-5-18-6-8-21-9-7-18/h2-3,17H,1,4-9H2,(H,19,20) |
| InChIKey | GJLVXHUEZMEULU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|