C14H20FN3OS — CID 63674197
5-fluoro-2-(3-morpholin-4-ylpropylamino)benzenecarbothioamide (PubChem CID 63674197) has the molecular formula C14H20FN3OS and a molecular weight of 297.40 g/mol. Its IUPAC name is 5-fluoro-2-(3-morpholin-4-ylpropylamino)benzenecarbothioamide.
| Compound Name | 5-fluoro-2-(3-morpholin-4-ylpropylamino)benzenecarbothioamide |
|---|---|
| PubChem CID | 63674197 |
| Molecular Formula | C14H20FN3OS |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 5-fluoro-2-(3-morpholin-4-ylpropylamino)benzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)ccc1NCCCN1CCOCC1 |
| InChI | InChI=1S/C14H20FN3OS/c15-11-2-3-13(12(10-11)14(16)20)17-4-1-5-18-6-8-19-9-7-18/h2-3,10,17H,1,4-9H2,(H2,16,20) |
| InChIKey | XEWVPOABUCUMLA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|