C14H20F2N4OS — CID 8657952
1-(2,4-difluoroanilino)-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 8657952) has the molecular formula C14H20F2N4OS and a molecular weight of 330.40 g/mol. Its IUPAC name is 1-(2,4-difluoroanilino)-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-(2,4-difluoroanilino)-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 8657952 |
| Molecular Formula | C14H20F2N4OS |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 1-(2,4-difluoroanilino)-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Fc1ccc(NNC(=S)NCCCN2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C14H20F2N4OS/c15-11-2-3-13(12(16)10-11)18-19-14(22)17-4-1-5-20-6-8-21-9-7-20/h2-3,10,18H,1,4-9H2,(H2,17,19,22) |
| InChIKey | FOQDKCGINXHQEN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 48.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|