C16H22ClFN4OS — CID 8826452
1-[(Z)-1-(2-chloro-4-fluorophenyl)ethylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 8826452) has the molecular formula C16H22ClFN4OS and a molecular weight of 372.90 g/mol. Its IUPAC name is 1-[(Z)-1-(2-chloro-4-fluorophenyl)ethylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(Z)-1-(2-chloro-4-fluorophenyl)ethylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 8826452 |
| Molecular Formula | C16H22ClFN4OS |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 1-[(Z)-1-(2-chloro-4-fluorophenyl)ethylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | C/C(=N/NC(=S)NCCCN1CCOCC1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C16H22ClFN4OS/c1-12(14-4-3-13(18)11-15(14)17)20-21-16(24)19-5-2-6-22-7-9-23-10-8-22/h3-4,11H,2,5-10H2,1H3,(H2,19,21,24)/b20-12- |
| InChIKey | VRSTWTKDPGHMLV-NDENLUEZSA-N |
| XLogP | 2.39 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|