C18H25N7OS — CID 29169323
1-(3-morpholin-4-ylpropyl)-3-[(Z)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethylideneamino]thiourea (PubChem CID 29169323) has the molecular formula C18H25N7OS and a molecular weight of 387.51 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-3-[(Z)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethylideneamino]thiourea.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-3-[(Z)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 29169323 |
| Molecular Formula | C18H25N7OS |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-3-[(Z)-1-[4-(1,2,4-triazol-1-yl)phenyl]ethylideneamino]thiourea |
| SMILES | C/C(=N/NC(=S)NCCCN1CCOCC1)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C18H25N7OS/c1-15(16-3-5-17(6-4-16)25-14-19-13-21-25)22-23-18(27)20-7-2-8-24-9-11-26-12-10-24/h3-6,13-14H,2,7-12H2,1H3,(H2,20,23,27)/b22-15- |
| InChIKey | LHOGBZONGKYDQB-JCMHNJIXSA-N |
| XLogP | 1.18 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|