C15H24N4OS2 — CID 9147403
1-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 9147403) has the molecular formula C15H24N4OS2 and a molecular weight of 340.52 g/mol. Its IUPAC name is 1-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 9147403 |
| Molecular Formula | C15H24N4OS2 |
| Molecular Weight | 340.52 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 1-[(Z)-1-(5-methylthiophen-2-yl)ethylideneamino]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | C/C(=N/NC(=S)NCCCN1CCOCC1)c1ccc(C)s1 |
| InChI | InChI=1S/C15H24N4OS2/c1-12-4-5-14(22-12)13(2)17-18-15(21)16-6-3-7-19-8-10-20-11-9-19/h4-5H,3,6-11H2,1-2H3,(H2,16,18,21)/b17-13- |
| InChIKey | NREZNGXIDXOCNT-LGMDPLHJSA-N |
| XLogP | 1.97 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.52 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|