C14H24N4OS — CID 111046021
2-[(5-methylthiophen-2-yl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine (PubChem CID 111046021) has the molecular formula C14H24N4OS and a molecular weight of 296.44 g/mol. Its IUPAC name is 2-[(5-methylthiophen-2-yl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine.
| Compound Name | 2-[(5-methylthiophen-2-yl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111046021 |
| Molecular Formula | C14H24N4OS |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 2-[(5-methylthiophen-2-yl)methyl]-1-(3-morpholin-4-ylpropyl)guanidine |
| SMILES | Cc1ccc(C/N=C(\N)NCCCN2CCOCC2)s1 |
| InChI | InChI=1S/C14H24N4OS/c1-12-3-4-13(20-12)11-17-14(15)16-5-2-6-18-7-9-19-10-8-18/h3-4H,2,5-11H2,1H3,(H3,15,16,17) |
| InChIKey | UTYMHEUCYWSFTL-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 62.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|