C12H23IN6O — CID 111070163
1-(3-morpholin-4-ylpropyl)-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide (PubChem CID 111070163) has the molecular formula C12H23IN6O and a molecular weight of 394.26 g/mol. Its IUPAC name is 1-(3-morpholin-4-ylpropyl)-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(3-morpholin-4-ylpropyl)-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111070163 |
| Molecular Formula | C12H23IN6O |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-(3-morpholin-4-ylpropyl)-2-(1H-pyrazol-5-ylmethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccn[nH]1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C12H22N6O.HI/c13-12(15-10-11-2-4-16-17-11)14-3-1-5-18-6-8-19-9-7-18;/h2,4H,1,3,5-10H2,(H,16,17)(H3,13,14,15);1H |
| InChIKey | BLMKHUKPOBFAKC-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|