C20H27FIN5O2 — CID 111091747
2-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111091747) has the molecular formula C20H27FIN5O2 and a molecular weight of 515.37 g/mol. Its IUPAC name is 2-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 2-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111091747 |
| Molecular Formula | C20H27FIN5O2 |
| Molecular Weight | 515.37 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 2-[[2-(4-fluorophenoxy)-4-pyridinyl]methyl]-1-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccnc(Oc2ccc(F)cc2)c1)NCCCN1CCOCC1 |
| InChI | InChI=1S/C20H26FN5O2.HI/c21-17-2-4-18(5-3-17)28-19-14-16(6-8-23-19)15-25-20(22)24-7-1-9-26-10-12-27-13-11-26;/h2-6,8,14H,1,7,9-13,15H2,(H3,22,24,25);1H |
| InChIKey | YDOVKXVKYSXORE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|